Quick Details
| Place of Origin:Fujian China (Mainland) | Brand Name:Yinjia | Model Number:AUTOJET/JETP |
| Theory:Automatic Booster System | Structure:Automatic Booster System | Usage:Water |
| Power:Electric | Standard or Nonstandard:Standard | Fuel:Electric |
| Pressure:High Pressure | Application:domestic and garden use | pumps:Automatic Booster systems |
| pump:booster pump system | impeller:ppo | using:domestic use |
| use:garden irrigation | ejector union:ppo |
Packaging & Delivery
| Packaging Detail: | carton boxes, wooden boxes, pallets |
| Delivery Detail | 30-40 days |
Specifications
Automatic Booster pump systems
1.pumping and distribution of water
2.booster system
3.washing systems,garden irrigation,
Automatic Booster pumpsystems
| TYPE | v/hz | POWER | uf | Ampere | M. Q | M. H | IMPELLER | DNA | DNM | |
| HP | KW | L/MIN | M | |||||||
| AUTOJETS60/24W | 220V/50HZ | 0.5 | 0.4 | 12 | 3.2 | 45 | 31 | BRASS | 1″ | 1″ |
| AUTOJETS80/24W | 220V/50HZ | 0.8 | 0.6 | 16 | 3.7 | 50 | 31 | BRASS | 1″ | 1″ |
| AUTOJETS100/24W | 220V/50HZ | 1 | 0.8 | 20 | 4.3 | 55 | 31 | BRASS | 1″ | 1″ |
| AUTOJET60/JETP60 | 220V/50HZ | 0.5 | 0.4 | 12 | 3.2 | 45 | 31 | BRASS | 1″ | 1″ |
| AUTOJET80/JETP80 | 220V/50HZ | 0.8 | 0.6 | 16 | 3.7 | 50 | 31 | BRASS | 1″ | 1″ |
| AUTOJET100 | 220V/50HZ | 1 | 0.8 | 20 | 4.3 | 55 | 31 | BRASS | 1″ | 1″ |
| AUTOJETP100 | 220V/50HZ | 1 | 0.8 | 20 | 4.3 | 55 | 31 | BRASS | 1″ | 1″ |
Application Limit
1.suction lift up to 9m with foot valve
2.Maximum operating pressure: 8 bar.
3.Maximum ambient temperature: + 40°C
4.Liquid temperature: +60°C
5.Maximun altitude: +1000m
Design parameters
1.Pump body: cast iron
2.Diffusers: PPO/Noryl
3.Impeller: Brass/ PPO/Noryl
4.Motor shaft: AISI1045
5.Mechanical seal:Nbr/graphite/ceramic
6.Pressure switch:Model sk-2(ON:1.38bar-OFF:2.76bar)
7.24 litres Cylindrical Tank with membeane.
8.Pressure Gauge: 6 bar
9.5way brass connector(YJR-G1”*50*80)
10.FLEXIBLE HOSE:YJFM-F1”*M1”*33*52
]]>